Download presentation
Presentation is loading. Please wait.
1
NUCLEIC ACIDS AS DRUG TARGETS
Patrick An Introduction to Medicinal Chemistry 3/e Chapter 7 NUCLEIC ACIDS AS DRUG TARGETS Part 2: Section 7.3 (Drugs acting on DNA)
2
Contents Part 2: Section 7.3 (Drugs acting on DNA) 3. Drugs acting on DNA 3.1. Intercalating agents - Topoisomerase II (6 slides) - Example – Proflavine (2 slides) - Examples - Examples – antimalarial agents 3.2. Alkylating agents (7 slides) 3.3. Chain cutters (3 slides) [21 slides]
3
3. DRUGS ACTING ON DNA 3.1 Intercalating agents Mechanism of action
Contain planar aromatic or heteroaromatic ring systems Planar systems slip between the layers of nucleic acid pairs and disrupt the shape of the helix Preference is often shown for the minor or major groove Intercalation prevents replication and transcription Intercalation inhibits topoisomerase II
4
3. DRUGS ACTING ON DNA Topoisomerase II
Relieves the strain in the DNA helix by temporarily cleaving the DNA chain and crossing an intact strand through the broken strand Tyrosine residues in the enzyme are involved in the chain breaking process The residues form covalent bonds to DNA
5
3. DRUGS ACTING ON DNA Topoisomerase II
Relieves the strain in the DNA helix by temporarily cleaving the DNA chain and crossing an intact strand through the broken strand Topo II Tyrosine residues in the enzyme are involved in the chain breaking process The residues form covalent bonds to DNA The enzyme pulls the chains apart to create a gap
6
3. DRUGS ACTING ON DNA Topoisomerase II
Relieves the strain in the DNA helix by temporarily cleaving the DNA chain and crossing an intact strand through the broken strand Tyrosine residues in the enzyme are involved in the chain breaking process The residues form covalent bonds to DNA The enzyme pulls the chains apart to create a gap The intact strand of DNA is passed through the gap
7
3. DRUGS ACTING ON DNA Topoisomerase II
Relieves the strain in the DNA helix by temporarily cleaving the DNA chain and crossing an intact strand through the broken strand Tyrosine residues in the enzyme are involved in the chain breaking process The residues form covalent bonds to DNA The enzyme pulls the chains apart to create a gap The intact strand of DNA is passed through the gap The break is resealed
8
3. DRUGS ACTING ON DNA Topoisomerase II
Relieves the strain in the DNA helix by temporarily cleaving the DNA chain and crossing an intact strand through the broken strand Tyrosine residues in the enzyme are involved in the chain breaking process The residues form covalent bonds to DNA The enzyme pulls the chains apart to create a gap The intact strand of DNA is passed through the gap The break is resealed
9
3. DRUGS ACTING ON DNA Topoisomerase II Mechanism of chain cutting
10
3. DRUGS ACTING ON DNA 3.1 Intercalating agents Example - Proflavine
Planar tricyclic system The amino substituents are protonated and charged Used as a topical antibacterial agent in the second world war Targets bacterial DNA Too toxic for systemic use
11
3. DRUGS ACTING ON DNA 3.1 Intercalating agents Example - Proflavine
DNA DOUBLE HELIX A G C van der Waals interactions Ionic interactions
12
3. DRUGS ACTING ON DNA 3.1 Intercalating agents Examples
Doxorubicin (Adriamycin) Dactinomycin Planar rings Planar rings Extra binding to sugar phosphate backbone by NH3 Extra binding to sugar phosphate backbone by cyclic peptide
13
3. DRUGS ACTING ON DNA 3.1 Intercalating agents
Examples- antimalarial agents Quinine Chloroquine
14
3. DRUGS ACTING ON DNA 3.2 Alkylating agents
Contain highly electrophilic groups Form covalent bonds to nucleophilic groups in DNA (e.g. 7-N of guanine) Prevent replication and transcription Useful anti-tumour agents Toxic side effects (e.g. alkylation of proteins) Example Mechlorethamine (nitrogen mustard)
15
3. DRUGS ACTING ON DNA 3.2 Alkylating agents Cross linking
Intrastrand cross linking Interstrand cross linking
16
3. DRUGS ACTING ON DNA 3.2 Alkylating agents Mechanism of action
Mechlorethamine Aziridine ion Crosslinked DNA
17
3. DRUGS ACTING ON DNA 3.2 Alkylating agents Mechlorethamine analogues
Aromatic ring - e withdrawing effect N is less nucleophilic Less reactive alkylating agent Selective for stronger nucleophiles (e.g. guanine) Uracil mustard Used vs leukaemia Attached to a nucleic acid building block Concentrated in fast growing cells (tumours) Some selectivity
18
3. DRUGS ACTING ON DNA 3.2 Alkylating agents Cisplatin Mitomycin C
Binds to DNA in regions rich in guanine units Intrastrand links rather than interstrand Inhibits transcription Converted to alkylating agent in the body
19
-MeOH Reduction Ring opening -H + Alkylating agent -CO2 -NH3 Crosslinked DNA
20
3. DRUGS ACTING ON DNA 3.3 Chain cutters
Bleomycin Used vs skin cancer BLEOMYCIN A R = NHCH2CH2CH2SMe2 BLEOMYCIN B R = NHCH2CH2CH2CH2NHC(NH2)=NH Abstracts H from DNA to generate radicals Radicals react with oxygen resulting in chain cutting Bleomycin also inhibits repair enzymes
21
3. DRUGS ACTING ON DNA 3.3 Chain cutters Generates DNA diradical
Calicheamicin g1I Antitumour agent Generates DNA diradical DNA diradical reacts with oxygen Results in chain cutting
22
3. DRUGS ACTING ON DNA 3.3 Chain cutters Michael addition
Cycloaromatisation O2 Oxidative cleavage
Similar presentations
