1. Cinda Sheldon Biochemistry Jeopardy Hydro- carbons CarbosLipidsPro- teins Nucl. acids Misc. 10 20 30 40 50

2. Cinda Sheldon Hydrocarbons $10 How many bonds can a carbon atom form with other atoms? 4

3. Cinda Sheldon Hydrocarbons $20 What are compounds with the same molecular formula, but arranged differently in their structures? isomers

4. Cinda Sheldon Hydrocarbons $30 What is the removing of water to join monomers called? What is the addition of water to split polymers called? Dehydration synthesis Hydrolysis

5. Cinda Sheldon Hydrocarbons $40 Match the functional groups: -COOHA. hydroxyl -NH 2 B. carboxyl -C=OC. carbonyl -OHD. amino B, D, C, A

6. Cinda Sheldon Hydrocarbons $50 Identify the triglyceride, disaccharide, amino acid and the nucleotide.

7. Cinda Sheldon Carbohydrates $10 What is the monomer of a carbohydrate called? monosaccharide

8. Cinda Sheldon Carbohydrates $20 Most sugars end in which suffix? Give two examples: -ose -glucose, sucrose, fructose, maltose

9. Cinda Sheldon Carbohydrates $30 Describe the test used to determine positive results for glucose and what the results would look like: Benedicts heated turns blue to orange-red

10. Cinda Sheldon Carbohydrates $40 Describe the positive test for starch: what is used and what a positive test looks like. Starch turns iodine from straw yellow to blue-black

11. Cinda Sheldon Carbohydrates $50 MATCH: 1. Cellulose A. polysacch. - plants 2. Glucose B. fiber from plants 3. GlycogenC. polysacch. - animals 4. StarchD. monosaccharide 5. SucroseE. disaccharide 1-B 2-D 3-C 4-A 5-E

12. Cinda Sheldon Lipids $10 Which best describes lipids? A. hydrophilic B. hydrophobic C. ionic D. polar covalent B “water fearing”

13. Cinda Sheldon Lipids $20 What is the monomer of lipids? Fatty acids and glycerol

14. Cinda Sheldon Lipids $30 A triglyceride has how many glycerols and how many fatty acids? 1 glycerol (backbone) 3 fatty acids

15. Cinda Sheldon Lipids $40 What kind of molecules are these lipids? steroids

16. Cinda Sheldon Lipids $50 CH3(CH2)4CH=CHCH2CH=CH(CH2)7COOH MATCH A. Monounsaturated B. Polyunsaturated C. Saturated

17. Cinda Sheldon Proteins $10 What is the monomer of proteins? Amino acids

18. Cinda Sheldon Proteins $20 How many different amino acids are there? How are they different? 20 R groups

19. Cinda Sheldon Protein $30 What does “denaturation” mean? What is a positive test for proteins in the lab? Unravel proteins Biurets turns from blue to purple

20. Cinda Sheldon Protein $40 Describe how each level of proteins are different:

21. Cinda Sheldon Protein $50 List and describe the seven types of proteins: Structural, storage, signal hormone, contractile, defensive, enzyme, transport

22. Cinda Sheldon Nucleic Acids $10 What is the monomer called of nucleic acids? nucleotide

23. Cinda Sheldon Nucleic Acids $20 What is the name of the element found in nucleic acids that is not found in the other macromolecules? P or phosphorus

24. Cinda Sheldon Nucleic Acids $30 What is the main job of nucleic acids? Store genetic information

25. Cinda Sheldon Nucleic Acids $40 List two examples of nucleic acids: DNA RNA

26. Cinda Sheldon Nucleic Acids $50 What are the three parts of nucleic acids? Sugar Phosphates Nitrogenous bases

27. Cinda Sheldon MISC. $10 Phospholipids, waxes, and steroids are all: A. proteinsC. nucleic acids B. fatsD. carbohydrates B. fats

28. Cinda Sheldon MISC. $20 Artherosclerosis (hardening of the arteries) is caused by what: Build-up of LDL’s

29. Cinda Sheldon Misc. $30 Which is not the same as the other three? A. protein B. amino acid chain C. polyunsaturate D. polypeptide polyunsaturate

30. Cinda Sheldon Misc. $40 What is the name of the bond that holds together: A. proteins B. nucleic acids A. Peptide B. hydrogen

31. Cinda Sheldon Misc. $50 What is: 1. shape of DNA 2. name of diff. part of amino acids 3. positive test for fats A. Helical B. R group C. Translucence on brown paper

32. Cinda Sheldon BONUS: Which is a monosaccharide and which is a disaccharide? Disaccharide Monosaccharide

33. Cinda Sheldon How can you tell fats from carbos? n Carbos n H:O n 2:1 n Fats n H:O n Greater than twice as many H as O CH3(CH2)10CO2H CH3(CH2)4(CH=CHCH2)4(CH2)2CO2H

34. Cinda Sheldon Where is this polysaccharide stored? n Glycogen n Cellulose n Starch n Liver and muscles in animals Cell walls of plants Plants (nuts, potatoes, etc.)

35. Cinda Sheldon What if starch underwent hydrolysis, what monomer would form? What test could you do to be sure that is what it is? n Glucose n Benedicts blue to orange-red

36. Cinda Sheldon Most common carbohydrate in the world? n A. glucose n B. cellulose n C. starch n D. phospholipid n ANSWER: cellulose

37. Cinda Sheldon Match the protein structure: 1. Made of 2 or more polypeptides B. Coiled or pleated C. Folded on itself(3-D globular or fibrous) 4. Sequence of Amino Acids A. Primary B. Secondary C. Tertiary D. Quaternary ANSWERS: 1-D, 2-B, 3-C, 4-A

38. Cinda Sheldon What two elements are hydrocrbons made of? n Carbon and hydrogen n Nitrogen and carbon n Oxygen and carbon n Hydrogen and oxygen n ANSWER: hydrogen and carbon